C21H26N2O5S — CID 52713270
N-[3-(4-methoxyphenyl)propyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 52713270) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)propyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[3-(4-methoxyphenyl)propyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 52713270 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[3-(4-methoxyphenyl)propyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(CCCNC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-27-19-9-7-17(8-10-19)4-3-11-22-21(24)18-5-2-6-20(16-18)29(25,26)23-12-14-28-15-13-23/h2,5-10,16H,3-4,11-15H2,1H3,(H,22,24) |
| InChIKey | CPAMXSZFQUSJIW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|