C20H23N3O7S — CID 26654349
N'-[2-(4-methoxyphenoxy)acetyl]-3-morpholin-4-ylsulfonylbenzohydrazide (PubChem CID 26654349) has the molecular formula C20H23N3O7S and a molecular weight of 449.49 g/mol. Its IUPAC name is N'-[2-(4-methoxyphenoxy)acetyl]-3-morpholin-4-ylsulfonylbenzohydrazide.
| Compound Name | N'-[2-(4-methoxyphenoxy)acetyl]-3-morpholin-4-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 26654349 |
| Molecular Formula | C20H23N3O7S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N'-[2-(4-methoxyphenoxy)acetyl]-3-morpholin-4-ylsulfonylbenzohydrazide |
| SMILES | COc1ccc(OCC(=O)NNC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C20H23N3O7S/c1-28-16-5-7-17(8-6-16)30-14-19(24)21-22-20(25)15-3-2-4-18(13-15)31(26,27)23-9-11-29-12-10-23/h2-8,13H,9-12,14H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | QFFWMKPWJYPNGQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|