C18H17Cl2N3O5S — CID 26654250
3,5-dichloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)benzohydrazide (PubChem CID 26654250) has the molecular formula C18H17Cl2N3O5S and a molecular weight of 458.32 g/mol. Its IUPAC name is 3,5-dichloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)benzohydrazide.
| Compound Name | 3,5-dichloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 26654250 |
| Molecular Formula | C18H17Cl2N3O5S |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 3,5-dichloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N3O5S/c19-14-8-13(9-15(20)11-14)18(25)22-21-17(24)12-2-1-3-16(10-12)29(26,27)23-4-6-28-7-5-23/h1-3,8-11H,4-7H2,(H,21,24)(H,22,25) |
| InChIKey | MSASXURIECSKSA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|