C17H18ClN3O6S2 — CID 42996196
N'-(2-chlorophenyl)sulfonyl-3-morpholin-4-ylsulfonylbenzohydrazide (PubChem CID 42996196) has the molecular formula C17H18ClN3O6S2 and a molecular weight of 459.93 g/mol. Its IUPAC name is N'-(2-chlorophenyl)sulfonyl-3-morpholin-4-ylsulfonylbenzohydrazide.
| Compound Name | N'-(2-chlorophenyl)sulfonyl-3-morpholin-4-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 42996196 |
| Molecular Formula | C17H18ClN3O6S2 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | N'-(2-chlorophenyl)sulfonyl-3-morpholin-4-ylsulfonylbenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccccc1Cl)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H18ClN3O6S2/c18-15-6-1-2-7-16(15)28(23,24)20-19-17(22)13-4-3-5-14(12-13)29(25,26)21-8-10-27-11-9-21/h1-7,12,20H,8-11H2,(H,19,22) |
| InChIKey | QVTPYLNFVXIDAK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|