C19H21N3O6S2 — CID 26969406
N'-(4-acetylphenyl)sulfonyl-3-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 26969406) has the molecular formula C19H21N3O6S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is N'-(4-acetylphenyl)sulfonyl-3-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-(4-acetylphenyl)sulfonyl-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 26969406 |
| Molecular Formula | C19H21N3O6S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | N'-(4-acetylphenyl)sulfonyl-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NNC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C19H21N3O6S2/c1-14(23)15-7-9-17(10-8-15)29(25,26)21-20-19(24)16-5-4-6-18(13-16)30(27,28)22-11-2-3-12-22/h4-10,13,21H,2-3,11-12H2,1H3,(H,20,24) |
| InChIKey | YHTRBQAXROAJNO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|