C18H20FN3O5S2 — CID 1140003
N'-(4-fluorophenyl)sulfonyl-4-piperidin-1-ylsulfonylbenzohydrazide (PubChem CID 1140003) has the molecular formula C18H20FN3O5S2 and a molecular weight of 441.51 g/mol. Its IUPAC name is N'-(4-fluorophenyl)sulfonyl-4-piperidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-(4-fluorophenyl)sulfonyl-4-piperidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 1140003 |
| Molecular Formula | C18H20FN3O5S2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N'-(4-fluorophenyl)sulfonyl-4-piperidin-1-ylsulfonylbenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(F)cc1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H20FN3O5S2/c19-15-6-10-16(11-7-15)28(24,25)21-20-18(23)14-4-8-17(9-5-14)29(26,27)22-12-2-1-3-13-22/h4-11,21H,1-3,12-13H2,(H,20,23) |
| InChIKey | FOHRIYWXIKTXKV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|