C19H18F5N3O3S — CID 26886262
4-(azepan-1-ylsulfonyl)-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide (PubChem CID 26886262) has the molecular formula C19H18F5N3O3S and a molecular weight of 463.43 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide |
|---|---|
| PubChem CID | 26886262 |
| Molecular Formula | C19H18F5N3O3S |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide |
| SMILES | O=C(NNc1c(F)c(F)c(F)c(F)c1F)c1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H18F5N3O3S/c20-13-14(21)16(23)18(17(24)15(13)22)25-26-19(28)11-5-7-12(8-6-11)31(29,30)27-9-3-1-2-4-10-27/h5-8,25H,1-4,9-10H2,(H,26,28) |
| InChIKey | LXKZWEHORMWCLM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|