C15H23N3O3S — CID 9163758
4-(azepan-1-ylsulfonyl)-N',N'-dimethylbenzohydrazide (PubChem CID 9163758) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N',N'-dimethylbenzohydrazide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 9163758 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N',N'-dimethylbenzohydrazide |
| SMILES | CN(C)NC(=O)c1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C15H23N3O3S/c1-17(2)16-15(19)13-7-9-14(10-8-13)22(20,21)18-11-5-3-4-6-12-18/h7-10H,3-6,11-12H2,1-2H3,(H,16,19) |
| InChIKey | RQOOMNQXOTXRAT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|