C24H29ClN4O6S2 — CID 3192879
1-(4-chlorophenyl)sulfonyl-N'-(4-piperidin-1-ylsulfonylbenzoyl)piperidine-4-carbohydrazide (PubChem CID 3192879) has the molecular formula C24H29ClN4O6S2 and a molecular weight of 569.11 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N'-(4-piperidin-1-ylsulfonylbenzoyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N'-(4-piperidin-1-ylsulfonylbenzoyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 3192879 |
| Molecular Formula | C24H29ClN4O6S2 |
| Molecular Weight | 569.11 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N'-(4-piperidin-1-ylsulfonylbenzoyl)piperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H29ClN4O6S2/c25-20-6-10-22(11-7-20)37(34,35)29-16-12-19(13-17-29)24(31)27-26-23(30)18-4-8-21(9-5-18)36(32,33)28-14-2-1-3-15-28/h4-11,19H,1-3,12-17H2,(H,26,30)(H,27,31) |
| InChIKey | LXINDZIEMNVCHR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.11 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|