C19H20ClN3O4S — CID 1472653
N'-benzoyl-1-(4-chlorophenyl)sulfonylpiperidine-4-carbohydrazide (PubChem CID 1472653) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is N'-benzoyl-1-(4-chlorophenyl)sulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-benzoyl-1-(4-chlorophenyl)sulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 1472653 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N'-benzoyl-1-(4-chlorophenyl)sulfonylpiperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H20ClN3O4S/c20-16-6-8-17(9-7-16)28(26,27)23-12-10-15(11-13-23)19(25)22-21-18(24)14-4-2-1-3-5-14/h1-9,15H,10-13H2,(H,21,24)(H,22,25) |
| InChIKey | VQANIIGOHYTUGN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|