C20H22ClN3O4S — CID 17368336
1-(4-chlorophenyl)sulfonyl-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]piperidine-4-carboxamide (PubChem CID 17368336) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17368336 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[(E)-1-(3-hydroxyphenyl)ethylideneamino]piperidine-4-carboxamide |
| SMILES | C/C(=N\NC(=O)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)c1cccc(O)c1 |
| InChI | InChI=1S/C20H22ClN3O4S/c1-14(16-3-2-4-18(25)13-16)22-23-20(26)15-9-11-24(12-10-15)29(27,28)19-7-5-17(21)6-8-19/h2-8,13,15,25H,9-12H2,1H3,(H,23,26)/b22-14+ |
| InChIKey | ZJCRJNBECKRKJM-HYARGMPZSA-N |
| XLogP | 2.99 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|