C20H21Cl2N3O3S — CID 46495512
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 46495512) has the molecular formula C20H21Cl2N3O3S and a molecular weight of 454.38 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46495512 |
| Molecular Formula | C20H21Cl2N3O3S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)N/N=C/c3ccc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H21Cl2N3O3S/c1-14-2-6-18(7-3-14)29(27,28)25-10-8-15(9-11-25)20(26)24-23-13-16-4-5-17(21)12-19(16)22/h2-7,12-13,15H,8-11H2,1H3,(H,24,26)/b23-13+ |
| InChIKey | SRXFXQGFMUAJQL-YDZHTSKRSA-N |
| XLogP | 3.85 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|