C24H22Cl2N4O5S2 — CID 124544409
(2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperazine-2-carboxamide (PubChem CID 124544409) has the molecular formula C24H22Cl2N4O5S2 and a molecular weight of 581.50 g/mol. Its IUPAC name is (2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperazine-2-carboxamide.
| Compound Name | (2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 124544409 |
| Molecular Formula | C24H22Cl2N4O5S2 |
| Molecular Weight | 581.50 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | (2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]piperazine-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1Cl)[C@@H]1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22Cl2N4O5S2/c25-19-12-11-18(22(26)15-19)16-27-28-24(31)23-17-29(36(32,33)20-7-3-1-4-8-20)13-14-30(23)37(34,35)21-9-5-2-6-10-21/h1-12,15-16,23H,13-14,17H2,(H,28,31)/b27-16-/t23-/m0/s1 |
| InChIKey | ZNWUHJBDAYAOQH-PXDDYHHSSA-N |
| XLogP | 3.21 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|