C32H35N5O5S2 — CID 98058763
(2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]piperazine-2-carboxamide (PubChem CID 98058763) has the molecular formula C32H35N5O5S2 and a molecular weight of 633.80 g/mol. Its IUPAC name is (2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]piperazine-2-carboxamide.
| Compound Name | (2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 98058763 |
| Molecular Formula | C32H35N5O5S2 |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | (2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]piperazine-2-carboxamide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=N\NC(=O)[C@@H]3CN(S(=O)(=O)c4ccccc4)CCN3S(=O)(=O)c3ccccc3)c2C)c(C)c1 |
| InChI | InChI=1S/C32H35N5O5S2/c1-23-15-16-30(24(2)19-23)37-25(3)20-27(26(37)4)21-33-34-32(38)31-22-35(43(39,40)28-11-7-5-8-12-28)17-18-36(31)44(41,42)29-13-9-6-10-14-29/h5-16,19-21,31H,17-18,22H2,1-4H3,(H,34,38)/b33-21-/t31-/m0/s1 |
| InChIKey | XDDMKAGMDJPYII-DTNLCIQKSA-N |
| XLogP | 3.93 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|