C26H28N4O7S2 — CID 137107512
(2R)-1,4-bis(benzenesulfonyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]piperazine-2-carboxamide (PubChem CID 137107512) has the molecular formula C26H28N4O7S2 and a molecular weight of 572.67 g/mol. Its IUPAC name is (2R)-1,4-bis(benzenesulfonyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]piperazine-2-carboxamide.
| Compound Name | (2R)-1,4-bis(benzenesulfonyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 137107512 |
| Molecular Formula | C26H28N4O7S2 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | (2R)-1,4-bis(benzenesulfonyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]piperazine-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H]2CN(S(=O)(=O)c3ccccc3)CCN2S(=O)(=O)c2ccccc2)ccc1O |
| InChI | InChI=1S/C26H28N4O7S2/c1-2-37-25-17-20(13-14-24(25)31)18-27-28-26(32)23-19-29(38(33,34)21-9-5-3-6-10-21)15-16-30(23)39(35,36)22-11-7-4-8-12-22/h3-14,17-18,23,31H,2,15-16,19H2,1H3,(H,28,32)/b27-18-/t23-/m1/s1 |
| InChIKey | WEIWHYJTLOITEX-FELXSTKCSA-N |
| XLogP | 2.01 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|