C27H28N4O9S2 — CID 124535306
[4-[(Z)-[[(2S)-1,4-bis(benzenesulfonyl)piperazine-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate (PubChem CID 124535306) has the molecular formula C27H28N4O9S2 and a molecular weight of 616.67 g/mol. Its IUPAC name is [4-[(Z)-[[(2S)-1,4-bis(benzenesulfonyl)piperazine-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate.
| Compound Name | [4-[(Z)-[[(2S)-1,4-bis(benzenesulfonyl)piperazine-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
|---|---|
| PubChem CID | 124535306 |
| Molecular Formula | C27H28N4O9S2 |
| Molecular Weight | 616.67 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | [4-[(Z)-[[(2S)-1,4-bis(benzenesulfonyl)piperazine-2-carbonyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(/C=N\NC(=O)[C@@H]2CN(S(=O)(=O)c3ccccc3)CCN2S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C27H28N4O9S2/c1-38-25-17-20(13-14-24(25)40-27(33)39-2)18-28-29-26(32)23-19-30(41(34,35)21-9-5-3-6-10-21)15-16-31(23)42(36,37)22-11-7-4-8-12-22/h3-14,17-18,23H,15-16,19H2,1-2H3,(H,29,32)/b28-18-/t23-/m0/s1 |
| InChIKey | DTKCBVVANOMSIL-BCDHINTGSA-N |
| XLogP | 2.05 |
| TPSA | 160.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.67 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|