C28H26N4O6S2 — CID 137107721
(2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]piperazine-2-carboxamide (PubChem CID 137107721) has the molecular formula C28H26N4O6S2 and a molecular weight of 578.67 g/mol. Its IUPAC name is (2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]piperazine-2-carboxamide.
| Compound Name | (2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 137107721 |
| Molecular Formula | C28H26N4O6S2 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | (2S)-1,4-bis(benzenesulfonyl)-N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]piperazine-2-carboxamide |
| SMILES | O=C(N/N=C\c1c(O)ccc2ccccc12)[C@@H]1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H26N4O6S2/c33-27-16-15-21-9-7-8-14-24(21)25(27)19-29-30-28(34)26-20-31(39(35,36)22-10-3-1-4-11-22)17-18-32(26)40(37,38)23-12-5-2-6-13-23/h1-16,19,26,33H,17-18,20H2,(H,30,34)/b29-19-/t26-/m0/s1 |
| InChIKey | XLHIZRDLUUDWBZ-BELHPSACSA-N |
| XLogP | 2.76 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|