C25H26N4O7S2 — CID 135716737
1,4-bis(benzenesulfonyl)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]piperazine-2-carboxamide (PubChem CID 135716737) has the molecular formula C25H26N4O7S2 and a molecular weight of 558.64 g/mol. Its IUPAC name is 1,4-bis(benzenesulfonyl)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]piperazine-2-carboxamide.
| Compound Name | 1,4-bis(benzenesulfonyl)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 135716737 |
| Molecular Formula | C25H26N4O7S2 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 1,4-bis(benzenesulfonyl)-N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]piperazine-2-carboxamide |
| SMILES | COc1cccc(/C=N/NC(=O)C2CN(S(=O)(=O)c3ccccc3)CCN2S(=O)(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C25H26N4O7S2/c1-36-23-14-8-9-19(24(23)30)17-26-27-25(31)22-18-28(37(32,33)20-10-4-2-5-11-20)15-16-29(22)38(34,35)21-12-6-3-7-13-21/h2-14,17,22,30H,15-16,18H2,1H3,(H,27,31)/b26-17+ |
| InChIKey | NFXLWKCLVFHXNS-YZSQISJMSA-N |
| XLogP | 1.61 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|