C20H22ClN3O5S — CID 71966714
1-(4-chlorophenyl)sulfonyl-N-[(2,3-dimethoxyphenyl)methylideneamino]pyrrolidine-2-carboxamide (PubChem CID 71966714) has the molecular formula C20H22ClN3O5S and a molecular weight of 451.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[(2,3-dimethoxyphenyl)methylideneamino]pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[(2,3-dimethoxyphenyl)methylideneamino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71966714 |
| Molecular Formula | C20H22ClN3O5S |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[(2,3-dimethoxyphenyl)methylideneamino]pyrrolidine-2-carboxamide |
| SMILES | COc1cccc(C=NNC(=O)C2CCCN2S(=O)(=O)c2ccc(Cl)cc2)c1OC |
| InChI | InChI=1S/C20H22ClN3O5S/c1-28-18-7-3-5-14(19(18)29-2)13-22-23-20(25)17-6-4-12-24(17)30(26,27)16-10-8-15(21)9-11-16/h3,5,7-11,13,17H,4,6,12H2,1-2H3,(H,23,25) |
| InChIKey | HHKMMBUUVKKSQT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|