C19H19Cl2N3O4S — CID 11840279
N-[(E)-(5-chloro-2-methoxyphenyl)methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 11840279) has the molecular formula C19H19Cl2N3O4S and a molecular weight of 456.35 g/mol. Its IUPAC name is N-[(E)-(5-chloro-2-methoxyphenyl)methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[(E)-(5-chloro-2-methoxyphenyl)methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11840279 |
| Molecular Formula | C19H19Cl2N3O4S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | N-[(E)-(5-chloro-2-methoxyphenyl)methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1/C=N/NC(=O)C1CCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2N3O4S/c1-28-18-9-6-15(21)11-13(18)12-22-23-19(25)17-3-2-10-24(17)29(26,27)16-7-4-14(20)5-8-16/h4-9,11-12,17H,2-3,10H2,1H3,(H,23,25)/b22-12+ |
| InChIKey | RBEQUMOFVVMNAC-WSDLNYQXSA-N |
| XLogP | 3.31 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|