C20H22ClN3O4S — CID 1232879
(2S)-1-(4-chlorophenyl)sulfonyl-N-[(3-ethoxyphenyl)methylideneamino]pyrrolidine-2-carboxamide (PubChem CID 1232879) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenyl)sulfonyl-N-[(3-ethoxyphenyl)methylideneamino]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(4-chlorophenyl)sulfonyl-N-[(3-ethoxyphenyl)methylideneamino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 1232879 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (2S)-1-(4-chlorophenyl)sulfonyl-N-[(3-ethoxyphenyl)methylideneamino]pyrrolidine-2-carboxamide |
| SMILES | CCOc1cccc(C=NNC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H22ClN3O4S/c1-2-28-17-6-3-5-15(13-17)14-22-23-20(25)19-7-4-12-24(19)29(26,27)18-10-8-16(21)9-11-18/h3,5-6,8-11,13-14,19H,2,4,7,12H2,1H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | OVUOTWKUHDZSJK-IBGZPJMESA-N |
| XLogP | 3.04 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|