C16H15BrClN3O4S — CID 5429088
(2R)-N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 5429088) has the molecular formula C16H15BrClN3O4S and a molecular weight of 460.74 g/mol. Its IUPAC name is (2R)-N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 5429088 |
| Molecular Formula | C16H15BrClN3O4S |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 458.97 |
| IUPAC Name | (2R)-N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Br)o1)[C@H]1CCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15BrClN3O4S/c17-15-8-5-12(25-15)10-19-20-16(22)14-2-1-9-21(14)26(23,24)13-6-3-11(18)4-7-13/h3-8,10,14H,1-2,9H2,(H,20,22)/b19-10-/t14-/m1/s1 |
| InChIKey | ZHNNFSLGGFBJKZ-SAGYFLTASA-N |
| XLogP | 3.00 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|