C26H25Cl2N3O5S — CID 129441487
(2S)-N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 129441487) has the molecular formula C26H25Cl2N3O5S and a molecular weight of 562.48 g/mol. Its IUPAC name is (2S)-N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129441487 |
| Molecular Formula | C26H25Cl2N3O5S |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | (2S)-N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | COc1cc(C=NNC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(Cl)cc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H25Cl2N3O5S/c1-35-25-15-19(6-13-24(25)36-17-18-4-7-20(27)8-5-18)16-29-30-26(32)23-3-2-14-31(23)37(33,34)22-11-9-21(28)10-12-22/h4-13,15-16,23H,2-3,14,17H2,1H3,(H,30,32)/t23-/m0/s1 |
| InChIKey | ZVGNOKPLPFFEKS-QHCPKHFHSA-N |
| XLogP | 4.88 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|