C24H25N3O6S2 — CID 2864807
1,4-bis(benzenesulfonyl)-N-(3-methoxyphenyl)piperazine-2-carboxamide (PubChem CID 2864807) has the molecular formula C24H25N3O6S2 and a molecular weight of 515.61 g/mol. Its IUPAC name is 1,4-bis(benzenesulfonyl)-N-(3-methoxyphenyl)piperazine-2-carboxamide.
| Compound Name | 1,4-bis(benzenesulfonyl)-N-(3-methoxyphenyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 2864807 |
| Molecular Formula | C24H25N3O6S2 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 1,4-bis(benzenesulfonyl)-N-(3-methoxyphenyl)piperazine-2-carboxamide |
| SMILES | COc1cccc(NC(=O)C2CN(S(=O)(=O)c3ccccc3)CCN2S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H25N3O6S2/c1-33-20-10-8-9-19(17-20)25-24(28)23-18-26(34(29,30)21-11-4-2-5-12-21)15-16-27(23)35(31,32)22-13-6-3-7-14-22/h2-14,17,23H,15-16,18H2,1H3,(H,25,28) |
| InChIKey | MVPVZBYZWSWGNF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |