C25H24ClN3O7S2 — CID 2954069
methyl 5-[[1,4-bis(benzenesulfonyl)piperazine-2-carbonyl]amino]-2-chlorobenzoate (PubChem CID 2954069) has the molecular formula C25H24ClN3O7S2 and a molecular weight of 578.07 g/mol. Its IUPAC name is methyl 5-[[1,4-bis(benzenesulfonyl)piperazine-2-carbonyl]amino]-2-chlorobenzoate.
| Compound Name | methyl 5-[[1,4-bis(benzenesulfonyl)piperazine-2-carbonyl]amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 2954069 |
| Molecular Formula | C25H24ClN3O7S2 |
| Molecular Weight | 578.07 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | methyl 5-[[1,4-bis(benzenesulfonyl)piperazine-2-carbonyl]amino]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)C2CN(S(=O)(=O)c3ccccc3)CCN2S(=O)(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C25H24ClN3O7S2/c1-36-25(31)21-16-18(12-13-22(21)26)27-24(30)23-17-28(37(32,33)19-8-4-2-5-9-19)14-15-29(23)38(34,35)20-10-6-3-7-11-20/h2-13,16,23H,14-15,17H2,1H3,(H,27,30) |
| InChIKey | ABRUPDFOTMUCGC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.07 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |