C27H31N3O5S2 — CID 124558467
(2R)-1,4-bis(benzenesulfonyl)-N-(4-butylphenyl)piperazine-2-carboxamide (PubChem CID 124558467) has the molecular formula C27H31N3O5S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is (2R)-1,4-bis(benzenesulfonyl)-N-(4-butylphenyl)piperazine-2-carboxamide.
| Compound Name | (2R)-1,4-bis(benzenesulfonyl)-N-(4-butylphenyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 124558467 |
| Molecular Formula | C27H31N3O5S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | (2R)-1,4-bis(benzenesulfonyl)-N-(4-butylphenyl)piperazine-2-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)[C@H]2CN(S(=O)(=O)c3ccccc3)CCN2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31N3O5S2/c1-2-3-10-22-15-17-23(18-16-22)28-27(31)26-21-29(36(32,33)24-11-6-4-7-12-24)19-20-30(26)37(34,35)25-13-8-5-9-14-25/h4-9,11-18,26H,2-3,10,19-21H2,1H3,(H,28,31)/t26-/m1/s1 |
| InChIKey | DOFKBXPCUIXNGS-AREMUKBSSA-N |
| XLogP | 3.73 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |