C33H37N3O5S2 — CID 3783251
N-[4-(1-adamantyl)phenyl]-1,4-bis(benzenesulfonyl)piperazine-2-carboxamide (PubChem CID 3783251) has the molecular formula C33H37N3O5S2 and a molecular weight of 619.81 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-1,4-bis(benzenesulfonyl)piperazine-2-carboxamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-1,4-bis(benzenesulfonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 3783251 |
| Molecular Formula | C33H37N3O5S2 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.22 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-1,4-bis(benzenesulfonyl)piperazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)C1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H37N3O5S2/c37-32(34-28-13-11-27(12-14-28)33-20-24-17-25(21-33)19-26(18-24)22-33)31-23-35(42(38,39)29-7-3-1-4-8-29)15-16-36(31)43(40,41)30-9-5-2-6-10-30/h1-14,24-26,31H,15-23H2,(H,34,37) |
| InChIKey | RODAGNWTXGAHKF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |