C24H24N4O6S2 — CID 126033759
(2R)-1,4-bis(benzenesulfonyl)-N-(2-carbamoylphenyl)piperazine-2-carboxamide (PubChem CID 126033759) has the molecular formula C24H24N4O6S2 and a molecular weight of 528.61 g/mol. Its IUPAC name is (2R)-1,4-bis(benzenesulfonyl)-N-(2-carbamoylphenyl)piperazine-2-carboxamide.
| Compound Name | (2R)-1,4-bis(benzenesulfonyl)-N-(2-carbamoylphenyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 126033759 |
| Molecular Formula | C24H24N4O6S2 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | (2R)-1,4-bis(benzenesulfonyl)-N-(2-carbamoylphenyl)piperazine-2-carboxamide |
| SMILES | NC(=O)c1ccccc1NC(=O)[C@H]1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O6S2/c25-23(29)20-13-7-8-14-21(20)26-24(30)22-17-27(35(31,32)18-9-3-1-4-10-18)15-16-28(22)36(33,34)19-11-5-2-6-12-19/h1-14,22H,15-17H2,(H2,25,29)(H,26,30)/t22-/m1/s1 |
| InChIKey | FQWAHXQVPMZCNC-JOCHJYFZSA-N |
| XLogP | 1.49 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |