C29H27N3O5S3 — CID 126266915
(2S)-1,4-bis(benzenesulfonyl)-N-(2-phenylsulfanylphenyl)piperazine-2-carboxamide (PubChem CID 126266915) has the molecular formula C29H27N3O5S3 and a molecular weight of 593.75 g/mol. Its IUPAC name is (2S)-1,4-bis(benzenesulfonyl)-N-(2-phenylsulfanylphenyl)piperazine-2-carboxamide.
| Compound Name | (2S)-1,4-bis(benzenesulfonyl)-N-(2-phenylsulfanylphenyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 126266915 |
| Molecular Formula | C29H27N3O5S3 |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.11 |
| IUPAC Name | (2S)-1,4-bis(benzenesulfonyl)-N-(2-phenylsulfanylphenyl)piperazine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Sc1ccccc1)[C@@H]1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H27N3O5S3/c33-29(30-26-18-10-11-19-28(26)38-23-12-4-1-5-13-23)27-22-31(39(34,35)24-14-6-2-7-15-24)20-21-32(27)40(36,37)25-16-8-3-9-17-25/h1-19,27H,20-22H2,(H,30,33)/t27-/m0/s1 |
| InChIKey | VQMBZCSJDZAQQD-MHZLTWQESA-N |
| XLogP | 4.54 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |