C25H27N3O5S2 — CID 1106368
(2R)-1,4-bis(benzenesulfonyl)-N-[(1R)-1-phenylethyl]piperazine-2-carboxamide (PubChem CID 1106368) has the molecular formula C25H27N3O5S2 and a molecular weight of 513.64 g/mol. Its IUPAC name is (2R)-1,4-bis(benzenesulfonyl)-N-[(1R)-1-phenylethyl]piperazine-2-carboxamide.
| Compound Name | (2R)-1,4-bis(benzenesulfonyl)-N-[(1R)-1-phenylethyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 1106368 |
| Molecular Formula | C25H27N3O5S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | (2R)-1,4-bis(benzenesulfonyl)-N-[(1R)-1-phenylethyl]piperazine-2-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@H]1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O5S2/c1-20(21-11-5-2-6-12-21)26-25(29)24-19-27(34(30,31)22-13-7-3-8-14-22)17-18-28(24)35(32,33)23-15-9-4-10-16-23/h2-16,20,24H,17-19H2,1H3,(H,26,29)/t20-,24-/m1/s1 |
| InChIKey | OQVRADSRCREGMR-HYBUGGRVSA-N |
| XLogP | 2.63 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |