C23H31N3O5S3 — CID 4994357
1,4-bis(benzenesulfonyl)-N-(2-tert-butylsulfanylethyl)piperazine-2-carboxamide (PubChem CID 4994357) has the molecular formula C23H31N3O5S3 and a molecular weight of 525.72 g/mol. Its IUPAC name is 1,4-bis(benzenesulfonyl)-N-(2-tert-butylsulfanylethyl)piperazine-2-carboxamide.
| Compound Name | 1,4-bis(benzenesulfonyl)-N-(2-tert-butylsulfanylethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 4994357 |
| Molecular Formula | C23H31N3O5S3 |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 1,4-bis(benzenesulfonyl)-N-(2-tert-butylsulfanylethyl)piperazine-2-carboxamide |
| SMILES | CC(C)(C)SCCNC(=O)C1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O5S3/c1-23(2,3)32-17-14-24-22(27)21-18-25(33(28,29)19-10-6-4-7-11-19)15-16-26(21)34(30,31)20-12-8-5-9-13-20/h4-13,21H,14-18H2,1-3H3,(H,24,27) |
| InChIKey | XHXDNLQSNJYNTK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|