C23H24N4O5S2 — CID 2864325
1,4-bis(benzenesulfonyl)-N-(pyridin-3-ylmethyl)piperazine-2-carboxamide (PubChem CID 2864325) has the molecular formula C23H24N4O5S2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 1,4-bis(benzenesulfonyl)-N-(pyridin-3-ylmethyl)piperazine-2-carboxamide.
| Compound Name | 1,4-bis(benzenesulfonyl)-N-(pyridin-3-ylmethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 2864325 |
| Molecular Formula | C23H24N4O5S2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 1,4-bis(benzenesulfonyl)-N-(pyridin-3-ylmethyl)piperazine-2-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H24N4O5S2/c28-23(25-17-19-8-7-13-24-16-19)22-18-26(33(29,30)20-9-3-1-4-10-20)14-15-27(22)34(31,32)21-11-5-2-6-12-21/h1-13,16,22H,14-15,17-18H2,(H,25,28) |
| InChIKey | GSYJFVWIOGZDBE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |