C24H25N3O3S — CID 53245887
(3R,6R)-N-benzyl-6-phenyl-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide (PubChem CID 53245887) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is (3R,6R)-N-benzyl-6-phenyl-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R,6R)-N-benzyl-6-phenyl-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 53245887 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (3R,6R)-N-benzyl-6-phenyl-1-pyridin-3-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1CC[C@H](c2ccccc2)N(S(=O)(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C24H25N3O3S/c28-24(26-16-19-8-3-1-4-9-19)21-13-14-23(20-10-5-2-6-11-20)27(18-21)31(29,30)22-12-7-15-25-17-22/h1-12,15,17,21,23H,13-14,16,18H2,(H,26,28)/t21-,23-/m1/s1 |
| InChIKey | XOEFNCLYVXCIIA-FYYLOGMGSA-N |
| XLogP | 3.54 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |