C20H25N3O3S — CID 3444702
4-(benzenesulfonamidomethyl)-N-(pyridin-3-ylmethyl)cyclohexane-1-carboxamide (PubChem CID 3444702) has the molecular formula C20H25N3O3S and a molecular weight of 387.50 g/mol. Its IUPAC name is 4-(benzenesulfonamidomethyl)-N-(pyridin-3-ylmethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(benzenesulfonamidomethyl)-N-(pyridin-3-ylmethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 3444702 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-(benzenesulfonamidomethyl)-N-(pyridin-3-ylmethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1CCC(CNS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H25N3O3S/c24-20(22-14-17-5-4-12-21-13-17)18-10-8-16(9-11-18)15-23-27(25,26)19-6-2-1-3-7-19/h1-7,12-13,16,18,23H,8-11,14-15H2,(H,22,24) |
| InChIKey | HOTZQTWTOJZVRL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |