C26H36N4O3S — CID 140618929
1-[4-[(4-cyclohexylcyclohexyl)methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 140618929) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is 1-[4-[(4-cyclohexylcyclohexyl)methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[(4-cyclohexylcyclohexyl)methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 140618929 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 1-[4-[(4-cyclohexylcyclohexyl)methylsulfamoyl]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)NCC2CCC(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C26H36N4O3S/c31-26(28-18-21-5-4-16-27-17-21)30-24-12-14-25(15-13-24)34(32,33)29-19-20-8-10-23(11-9-20)22-6-2-1-3-7-22/h4-5,12-17,20,22-23,29H,1-3,6-11,18-19H2,(H2,28,30,31) |
| InChIKey | RXXIMKWYOCNIGY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |