C17H20N4O3S2 — CID 66610991
1-(pyridin-3-ylmethyl)-3-(4-thiomorpholin-4-ylsulfonylphenyl)urea (PubChem CID 66610991) has the molecular formula C17H20N4O3S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 1-(pyridin-3-ylmethyl)-3-(4-thiomorpholin-4-ylsulfonylphenyl)urea.
| Compound Name | 1-(pyridin-3-ylmethyl)-3-(4-thiomorpholin-4-ylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 66610991 |
| Molecular Formula | C17H20N4O3S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-(pyridin-3-ylmethyl)-3-(4-thiomorpholin-4-ylsulfonylphenyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C17H20N4O3S2/c22-17(19-13-14-2-1-7-18-12-14)20-15-3-5-16(6-4-15)26(23,24)21-8-10-25-11-9-21/h1-7,12H,8-11,13H2,(H2,19,20,22) |
| InChIKey | MBJRZFBANDFYMI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |