C23H30ClN5O3S — CID 140618922
1-[4-[4-(3-chlorocyclohexyl)piperazin-1-yl]sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 140618922) has the molecular formula C23H30ClN5O3S and a molecular weight of 492.05 g/mol. Its IUPAC name is 1-[4-[4-(3-chlorocyclohexyl)piperazin-1-yl]sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[4-(3-chlorocyclohexyl)piperazin-1-yl]sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 140618922 |
| Molecular Formula | C23H30ClN5O3S |
| Molecular Weight | 492.05 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 1-[4-[4-(3-chlorocyclohexyl)piperazin-1-yl]sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)N2CCN(C3CCCC(Cl)C3)CC2)cc1 |
| InChI | InChI=1S/C23H30ClN5O3S/c24-19-4-1-5-21(15-19)28-11-13-29(14-12-28)33(31,32)22-8-6-20(7-9-22)27-23(30)26-17-18-3-2-10-25-16-18/h2-3,6-10,16,19,21H,1,4-5,11-15,17H2,(H2,26,27,30) |
| InChIKey | PNBWAMFIBBQRSD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.05 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|