C24H31ClN4O4S — CID 140926115
1-[4-[4-(3-chlorocyclohexyl)-4-hydroxypiperidin-1-yl]sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 140926115) has the molecular formula C24H31ClN4O4S and a molecular weight of 507.06 g/mol. Its IUPAC name is 1-[4-[4-(3-chlorocyclohexyl)-4-hydroxypiperidin-1-yl]sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[4-(3-chlorocyclohexyl)-4-hydroxypiperidin-1-yl]sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 140926115 |
| Molecular Formula | C24H31ClN4O4S |
| Molecular Weight | 507.06 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 1-[4-[4-(3-chlorocyclohexyl)-4-hydroxypiperidin-1-yl]sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(S(=O)(=O)N2CCC(O)(C3CCCC(Cl)C3)CC2)cc1 |
| InChI | InChI=1S/C24H31ClN4O4S/c25-20-5-1-4-19(15-20)24(31)10-13-29(14-11-24)34(32,33)22-8-6-21(7-9-22)28-23(30)27-17-18-3-2-12-26-16-18/h2-3,6-9,12,16,19-20,31H,1,4-5,10-11,13-15,17H2,(H2,27,28,30) |
| InChIKey | MBUXKUDBCNCETL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.06 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|