C22H30N4O3S — CID 123334685
1-[4-(3,5-diethylpiperidin-1-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 123334685) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is 1-[4-(3,5-diethylpiperidin-1-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-(3,5-diethylpiperidin-1-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 123334685 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-[4-(3,5-diethylpiperidin-1-yl)sulfonylphenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | CCC1CC(CC)CN(S(=O)(=O)c2ccc(NC(=O)NCc3cccnc3)cc2)C1 |
| InChI | InChI=1S/C22H30N4O3S/c1-3-17-12-18(4-2)16-26(15-17)30(28,29)21-9-7-20(8-10-21)25-22(27)24-14-19-6-5-11-23-13-19/h5-11,13,17-18H,3-4,12,14-16H2,1-2H3,(H2,24,25,27) |
| InChIKey | ZIWKGMDDQTWHAD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |