C32H31N3O4S — CID 68884920
1-(benzenesulfonyl)-N-benzyl-4-(2,2-diphenylacetyl)piperazine-2-carboxamide (PubChem CID 68884920) has the molecular formula C32H31N3O4S and a molecular weight of 553.68 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-benzyl-4-(2,2-diphenylacetyl)piperazine-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-benzyl-4-(2,2-diphenylacetyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 68884920 |
| Molecular Formula | C32H31N3O4S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 1-(benzenesulfonyl)-N-benzyl-4-(2,2-diphenylacetyl)piperazine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CN(C(=O)C(c2ccccc2)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H31N3O4S/c36-31(33-23-25-13-5-1-6-14-25)29-24-34(21-22-35(29)40(38,39)28-19-11-4-12-20-28)32(37)30(26-15-7-2-8-16-26)27-17-9-3-10-18-27/h1-20,29-30H,21-24H2,(H,33,36) |
| InChIKey | IKIVRXHFUSYAER-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |