C19H22N2O6S2 — CID 40836445
ethyl (2R)-1,4-bis(benzenesulfonyl)piperazine-2-carboxylate (PubChem CID 40836445) has the molecular formula C19H22N2O6S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is ethyl (2R)-1,4-bis(benzenesulfonyl)piperazine-2-carboxylate.
| Compound Name | ethyl (2R)-1,4-bis(benzenesulfonyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 40836445 |
| Molecular Formula | C19H22N2O6S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | ethyl (2R)-1,4-bis(benzenesulfonyl)piperazine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CN(S(=O)(=O)c2ccccc2)CCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O6S2/c1-2-27-19(22)18-15-20(28(23,24)16-9-5-3-6-10-16)13-14-21(18)29(25,26)17-11-7-4-8-12-17/h3-12,18H,2,13-15H2,1H3/t18-/m1/s1 |
| InChIKey | DYKJERXKDLJEJY-GOSISDBHSA-N |
| XLogP | 1.31 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |