C13H18N2O6S2 — CID 7161589
methyl (2S)-4-(benzenesulfonyl)-1-methylsulfonylpiperazine-2-carboxylate (PubChem CID 7161589) has the molecular formula C13H18N2O6S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl (2S)-4-(benzenesulfonyl)-1-methylsulfonylpiperazine-2-carboxylate.
| Compound Name | methyl (2S)-4-(benzenesulfonyl)-1-methylsulfonylpiperazine-2-carboxylate |
|---|---|
| PubChem CID | 7161589 |
| Molecular Formula | C13H18N2O6S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | methyl (2S)-4-(benzenesulfonyl)-1-methylsulfonylpiperazine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(S(=O)(=O)c2ccccc2)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C13H18N2O6S2/c1-21-13(16)12-10-14(8-9-15(12)22(2,17)18)23(19,20)11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | BQLFZPWLVFZTOT-LBPRGKRZSA-N |
| XLogP | -0.51 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |