C14H19N3O5S — CID 7161590
methyl (2S)-1-methylsulfonyl-4-(phenylcarbamoyl)piperazine-2-carboxylate (PubChem CID 7161590) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is methyl (2S)-1-methylsulfonyl-4-(phenylcarbamoyl)piperazine-2-carboxylate.
| Compound Name | methyl (2S)-1-methylsulfonyl-4-(phenylcarbamoyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 7161590 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | methyl (2S)-1-methylsulfonyl-4-(phenylcarbamoyl)piperazine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(=O)Nc2ccccc2)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C14H19N3O5S/c1-22-13(18)12-10-16(8-9-17(12)23(2,20)21)14(19)15-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,15,19)/t12-/m0/s1 |
| InChIKey | CYUCRHVDJYXVFL-LBPRGKRZSA-N |
| XLogP | 0.34 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |