C15H21N3O3S — CID 3235269
7-methylsulfonyl-N-phenyl-2,7-diazaspiro[3.5]nonane-2-carboxamide (PubChem CID 3235269) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 7-methylsulfonyl-N-phenyl-2,7-diazaspiro[3.5]nonane-2-carboxamide.
| Compound Name | 7-methylsulfonyl-N-phenyl-2,7-diazaspiro[3.5]nonane-2-carboxamide |
|---|---|
| PubChem CID | 3235269 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 7-methylsulfonyl-N-phenyl-2,7-diazaspiro[3.5]nonane-2-carboxamide |
| SMILES | CS(=O)(=O)N1CCC2(CC1)CN(C(=O)Nc1ccccc1)C2 |
| InChI | InChI=1S/C15H21N3O3S/c1-22(20,21)18-9-7-15(8-10-18)11-17(12-15)14(19)16-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3,(H,16,19) |
| InChIKey | MIPCJURDXWBZGS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |