C11H21N3O5S — CID 78455003
methyl 1-methylsulfonyl-4-(propan-2-ylcarbamoyl)piperazine-2-carboxylate (PubChem CID 78455003) has the molecular formula C11H21N3O5S and a molecular weight of 307.37 g/mol. Its IUPAC name is methyl 1-methylsulfonyl-4-(propan-2-ylcarbamoyl)piperazine-2-carboxylate.
| Compound Name | methyl 1-methylsulfonyl-4-(propan-2-ylcarbamoyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 78455003 |
| Molecular Formula | C11H21N3O5S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | methyl 1-methylsulfonyl-4-(propan-2-ylcarbamoyl)piperazine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)NC(C)C)CCN1S(C)(=O)=O |
| InChI | InChI=1S/C11H21N3O5S/c1-8(2)12-11(16)13-5-6-14(20(4,17)18)9(7-13)10(15)19-3/h8-9H,5-7H2,1-4H3,(H,12,16) |
| InChIKey | UEBNQXDKLRNZGE-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |