C18H24N4O5 — CID 163039377
methyl (2R)-2-[[(2S)-1-acetyl-4-(phenylcarbamoyl)piperazine-2-carbonyl]amino]propanoate (PubChem CID 163039377) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl (2R)-2-[[(2S)-1-acetyl-4-(phenylcarbamoyl)piperazine-2-carbonyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[(2S)-1-acetyl-4-(phenylcarbamoyl)piperazine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 163039377 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | methyl (2R)-2-[[(2S)-1-acetyl-4-(phenylcarbamoyl)piperazine-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)[C@@H]1CN(C(=O)Nc2ccccc2)CCN1C(C)=O |
| InChI | InChI=1S/C18H24N4O5/c1-12(17(25)27-3)19-16(24)15-11-21(9-10-22(15)13(2)23)18(26)20-14-7-5-4-6-8-14/h4-8,12,15H,9-11H2,1-3H3,(H,19,24)(H,20,26)/t12-,15+/m1/s1 |
| InChIKey | GIEJCGRIKQZDTH-DOMZBBRYSA-N |
| XLogP | 0.43 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |