C18H19N3O5S — CID 44783646
methyl 4-(benzenesulfonyl)-1-(pyridine-3-carbonyl)piperazine-2-carboxylate (PubChem CID 44783646) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is methyl 4-(benzenesulfonyl)-1-(pyridine-3-carbonyl)piperazine-2-carboxylate.
| Compound Name | methyl 4-(benzenesulfonyl)-1-(pyridine-3-carbonyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 44783646 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | methyl 4-(benzenesulfonyl)-1-(pyridine-3-carbonyl)piperazine-2-carboxylate |
| SMILES | COC(=O)C1CN(S(=O)(=O)c2ccccc2)CCN1C(=O)c1cccnc1 |
| InChI | InChI=1S/C18H19N3O5S/c1-26-18(23)16-13-20(27(24,25)15-7-3-2-4-8-15)10-11-21(16)17(22)14-6-5-9-19-12-14/h2-9,12,16H,10-11,13H2,1H3 |
| InChIKey | WVWGERGHKLPMCC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |