C18H17Cl2N3O4S — CID 69362944
4-(benzenesulfonyl)-1-(3,4-dichlorobenzoyl)piperazine-2-carboxamide (PubChem CID 69362944) has the molecular formula C18H17Cl2N3O4S and a molecular weight of 442.32 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1-(3,4-dichlorobenzoyl)piperazine-2-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-1-(3,4-dichlorobenzoyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 69362944 |
| Molecular Formula | C18H17Cl2N3O4S |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 4-(benzenesulfonyl)-1-(3,4-dichlorobenzoyl)piperazine-2-carboxamide |
| SMILES | NC(=O)C1CN(S(=O)(=O)c2ccccc2)CCN1C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N3O4S/c19-14-7-6-12(10-15(14)20)18(25)23-9-8-22(11-16(23)17(21)24)28(26,27)13-4-2-1-3-5-13/h1-7,10,16H,8-9,11H2,(H2,21,24) |
| InChIKey | YJHWISAEAWHJHL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |