C18H16Cl2N2O2 — CID 142087798
1-[4-(3,4-dichlorophenyl)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 142087798) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorophenyl)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[4-(3,4-dichlorophenyl)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142087798 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1-[4-(3,4-dichlorophenyl)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C(=O)c1ccc(-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c19-14-8-7-13(10-15(14)20)11-3-5-12(6-4-11)18(24)22-9-1-2-16(22)17(21)23/h3-8,10,16H,1-2,9H2,(H2,21,23) |
| InChIKey | SKISVNRDNCHAGI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |