C18H15F3N2O2 — CID 96510202
(2S)-1-[4-(3,4,5-trifluorophenyl)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 96510202) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is (2S)-1-[4-(3,4,5-trifluorophenyl)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[4-(3,4,5-trifluorophenyl)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 96510202 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2S)-1-[4-(3,4,5-trifluorophenyl)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN1C(=O)c1ccc(-c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H15F3N2O2/c19-13-8-12(9-14(20)16(13)21)10-3-5-11(6-4-10)18(25)23-7-1-2-15(23)17(22)24/h3-6,8-9,15H,1-2,7H2,(H2,22,24)/t15-/m0/s1 |
| InChIKey | PYSKWWCTQVJQEO-HNNXBMFYSA-N |
| XLogP | 2.86 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|